C9H15ClN4O3S — CID 133354069
6-chloro-4-N-[2-(2-methylsulfonylethoxy)ethyl]pyrimidine-2,4-diamine (PubChem CID 133354069) has the molecular formula C9H15ClN4O3S and a molecular weight of 294.76 g/mol. Its IUPAC name is 6-chloro-4-N-[2-(2-methylsulfonylethoxy)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[2-(2-methylsulfonylethoxy)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133354069 |
| Molecular Formula | C9H15ClN4O3S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 6-chloro-4-N-[2-(2-methylsulfonylethoxy)ethyl]pyrimidine-2,4-diamine |
| SMILES | CS(=O)(=O)CCOCCNc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C9H15ClN4O3S/c1-18(15,16)5-4-17-3-2-12-8-6-7(10)13-9(11)14-8/h6H,2-5H2,1H3,(H3,11,12,13,14) |
| InChIKey | PQZRZRRCBOCRSR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|