C8H15N5O2S — CID 80812862
4-N-(3-methylsulfonylpropyl)pyrimidine-2,4,6-triamine (PubChem CID 80812862) has the molecular formula C8H15N5O2S and a molecular weight of 245.31 g/mol. Its IUPAC name is 4-N-(3-methylsulfonylpropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(3-methylsulfonylpropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80812862 |
| Molecular Formula | C8H15N5O2S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 4-N-(3-methylsulfonylpropyl)pyrimidine-2,4,6-triamine |
| SMILES | CS(=O)(=O)CCCNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H15N5O2S/c1-16(14,15)4-2-3-11-7-5-6(9)12-8(10)13-7/h5H,2-4H2,1H3,(H5,9,10,11,12,13) |
| InChIKey | XYGNXKDZXXZPHP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|