C8H10Cl2N4O — CID 130569693
2-[(2,6-dichloropyrimidin-4-yl)amino]-N,N-dimethylacetamide (PubChem CID 130569693) has the molecular formula C8H10Cl2N4O and a molecular weight of 249.10 g/mol. Its IUPAC name is 2-[(2,6-dichloropyrimidin-4-yl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2,6-dichloropyrimidin-4-yl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 130569693 |
| Molecular Formula | C8H10Cl2N4O |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 2-[(2,6-dichloropyrimidin-4-yl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C8H10Cl2N4O/c1-14(2)7(15)4-11-6-3-5(9)12-8(10)13-6/h3H,4H2,1-2H3,(H,11,12,13) |
| InChIKey | FUWCBXCVIOFFCQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |