C7H8Cl2N4O2 — CID 130569835
3-[(2,6-dichloropyrimidin-4-yl)amino]-2-hydroxypropanamide (PubChem CID 130569835) has the molecular formula C7H8Cl2N4O2 and a molecular weight of 251.07 g/mol. Its IUPAC name is 3-[(2,6-dichloropyrimidin-4-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(2,6-dichloropyrimidin-4-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 130569835 |
| Molecular Formula | C7H8Cl2N4O2 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 3-[(2,6-dichloropyrimidin-4-yl)amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C7H8Cl2N4O2/c8-4-1-5(13-7(9)12-4)11-2-3(14)6(10)15/h1,3,14H,2H2,(H2,10,15)(H,11,12,13) |
| InChIKey | KGDAPWPGGCOSMM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |