C7H9Cl2N3O2 — CID 118686089
2-[(2,6-dichloropyrimidin-4-yl)amino]propane-1,3-diol (PubChem CID 118686089) has the molecular formula C7H9Cl2N3O2 and a molecular weight of 238.07 g/mol. Its IUPAC name is 2-[(2,6-dichloropyrimidin-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(2,6-dichloropyrimidin-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 118686089 |
| Molecular Formula | C7H9Cl2N3O2 |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 2-[(2,6-dichloropyrimidin-4-yl)amino]propane-1,3-diol |
| SMILES | OCC(CO)Nc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C7H9Cl2N3O2/c8-5-1-6(12-7(9)11-5)10-4(2-13)3-14/h1,4,13-14H,2-3H2,(H,10,11,12) |
| InChIKey | MMNZEROOJVKCOY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |