C8H12ClN3O — CID 60726838
2-[(2-chloropyrimidin-4-yl)amino]butan-1-ol (PubChem CID 60726838) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 2-[(2-chloropyrimidin-4-yl)amino]butan-1-ol.
| Compound Name | 2-[(2-chloropyrimidin-4-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 60726838 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-[(2-chloropyrimidin-4-yl)amino]butan-1-ol |
| SMILES | CCC(CO)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C8H12ClN3O/c1-2-6(5-13)11-7-3-4-10-8(9)12-7/h3-4,6,13H,2,5H2,1H3,(H,10,11,12) |
| InChIKey | LCOOOHJVCOYWFW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |