C9H13ClN2O — CID 93033854
(2S)-2-[(3-chloro-2-pyridinyl)amino]butan-1-ol (PubChem CID 93033854) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-2-pyridinyl)amino]butan-1-ol.
| Compound Name | (2S)-2-[(3-chloro-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 93033854 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (2S)-2-[(3-chloro-2-pyridinyl)amino]butan-1-ol |
| SMILES | CC[C@@H](CO)Nc1ncccc1Cl |
| InChI | InChI=1S/C9H13ClN2O/c1-2-7(6-13)12-9-8(10)4-3-5-11-9/h3-5,7,13H,2,6H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | FHYZYZHEXPOMRE-ZETCQYMHSA-N |
| XLogP | 1.92 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |