C8H14N4O — CID 131154572
(2S)-2-[(3-aminopyrazin-2-yl)amino]butan-1-ol (PubChem CID 131154572) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is (2S)-2-[(3-aminopyrazin-2-yl)amino]butan-1-ol.
| Compound Name | (2S)-2-[(3-aminopyrazin-2-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 131154572 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (2S)-2-[(3-aminopyrazin-2-yl)amino]butan-1-ol |
| SMILES | CC[C@@H](CO)Nc1nccnc1N |
| InChI | InChI=1S/C8H14N4O/c1-2-6(5-13)12-8-7(9)10-3-4-11-8/h3-4,6,13H,2,5H2,1H3,(H2,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | TZIJLUROEFEZID-LURJTMIESA-N |
| XLogP | 0.24 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |