C8H13N3O — CID 43388780
2-(pyrazin-2-ylamino)butan-1-ol (PubChem CID 43388780) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(pyrazin-2-ylamino)butan-1-ol.
| Compound Name | 2-(pyrazin-2-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 43388780 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(pyrazin-2-ylamino)butan-1-ol |
| SMILES | CCC(CO)Nc1cnccn1 |
| InChI | InChI=1S/C8H13N3O/c1-2-7(6-12)11-8-5-9-3-4-10-8/h3-5,7,12H,2,6H2,1H3,(H,10,11) |
| InChIKey | YOWZIKXWIHDFEZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |