C9H13IN2O — CID 130736106
(2S)-2-[(3-iodo-2-pyridinyl)amino]butan-1-ol (PubChem CID 130736106) has the molecular formula C9H13IN2O and a molecular weight of 292.12 g/mol. Its IUPAC name is (2S)-2-[(3-iodo-2-pyridinyl)amino]butan-1-ol.
| Compound Name | (2S)-2-[(3-iodo-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 130736106 |
| Molecular Formula | C9H13IN2O |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (2S)-2-[(3-iodo-2-pyridinyl)amino]butan-1-ol |
| SMILES | CC[C@@H](CO)Nc1ncccc1I |
| InChI | InChI=1S/C9H13IN2O/c1-2-7(6-13)12-9-8(10)4-3-5-11-9/h3-5,7,13H,2,6H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | YEFAWILPQOKTED-ZETCQYMHSA-N |
| XLogP | 1.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|