C8H11IN2O — CID 130724684
1-[(3-iodo-2-pyridinyl)amino]propan-2-ol (PubChem CID 130724684) has the molecular formula C8H11IN2O and a molecular weight of 278.09 g/mol. Its IUPAC name is 1-[(3-iodo-2-pyridinyl)amino]propan-2-ol.
| Compound Name | 1-[(3-iodo-2-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 130724684 |
| Molecular Formula | C8H11IN2O |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 1-[(3-iodo-2-pyridinyl)amino]propan-2-ol |
| SMILES | CC(O)CNc1ncccc1I |
| InChI | InChI=1S/C8H11IN2O/c1-6(12)5-11-8-7(9)3-2-4-10-8/h2-4,6,12H,5H2,1H3,(H,10,11) |
| InChIKey | GHBBAHPKLOLTPE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|