C9H16N4O — CID 102984478
3-N-(1-methoxybutan-2-yl)pyrazine-2,3-diamine (PubChem CID 102984478) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-N-(1-methoxybutan-2-yl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(1-methoxybutan-2-yl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 102984478 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-N-(1-methoxybutan-2-yl)pyrazine-2,3-diamine |
| SMILES | CCC(COC)Nc1nccnc1N |
| InChI | InChI=1S/C9H16N4O/c1-3-7(6-14-2)13-9-8(10)11-4-5-12-9/h4-5,7H,3,6H2,1-2H3,(H2,10,11)(H,12,13) |
| InChIKey | UXWDKBWXQLIUGR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |