C10H15ClN2O — CID 115689298
3-[(3-chloro-2-pyridinyl)amino]-2-methylbutan-1-ol (PubChem CID 115689298) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 3-[(3-chloro-2-pyridinyl)amino]-2-methylbutan-1-ol.
| Compound Name | 3-[(3-chloro-2-pyridinyl)amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 115689298 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-[(3-chloro-2-pyridinyl)amino]-2-methylbutan-1-ol |
| SMILES | CC(CO)C(C)Nc1ncccc1Cl |
| InChI | InChI=1S/C10H15ClN2O/c1-7(6-14)8(2)13-10-9(11)4-3-5-12-10/h3-5,7-8,14H,6H2,1-2H3,(H,12,13) |
| InChIKey | GKCJCPXJMGYGPU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |