C10H13ClN2O — CID 124616320
(2S)-2-[(3-chloro-2-pyridinyl)amino]pent-4-en-1-ol (PubChem CID 124616320) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-2-pyridinyl)amino]pent-4-en-1-ol.
| Compound Name | (2S)-2-[(3-chloro-2-pyridinyl)amino]pent-4-en-1-ol |
|---|---|
| PubChem CID | 124616320 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (2S)-2-[(3-chloro-2-pyridinyl)amino]pent-4-en-1-ol |
| SMILES | C=CC[C@@H](CO)Nc1ncccc1Cl |
| InChI | InChI=1S/C10H13ClN2O/c1-2-4-8(7-14)13-10-9(11)5-3-6-12-10/h2-3,5-6,8,14H,1,4,7H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | OJJVLXDIUFSXNQ-QMMMGPOBSA-N |
| XLogP | 2.08 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|