C10H11ClN2 — CID 115689385
3-chloro-N-pent-4-yn-2-ylpyridin-2-amine (PubChem CID 115689385) has the molecular formula C10H11ClN2 and a molecular weight of 194.67 g/mol. Its IUPAC name is 3-chloro-N-pent-4-yn-2-ylpyridin-2-amine.
| Compound Name | 3-chloro-N-pent-4-yn-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 115689385 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 3-chloro-N-pent-4-yn-2-ylpyridin-2-amine |
| SMILES | C#CCC(C)Nc1ncccc1Cl |
| InChI | InChI=1S/C10H11ClN2/c1-3-5-8(2)13-10-9(11)6-4-7-12-10/h1,4,6-8H,5H2,2H3,(H,12,13) |
| InChIKey | IJANANHFBSNJGB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|