C9H11N3 — CID 115658926
N-pent-4-yn-2-ylpyrimidin-2-amine (PubChem CID 115658926) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is N-pent-4-yn-2-ylpyrimidin-2-amine.
| Compound Name | N-pent-4-yn-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 115658926 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-pent-4-yn-2-ylpyrimidin-2-amine |
| SMILES | C#CCC(C)Nc1ncccn1 |
| InChI | InChI=1S/C9H11N3/c1-3-5-8(2)12-9-10-6-4-7-11-9/h1,4,6-8H,5H2,2H3,(H,10,11,12) |
| InChIKey | FJRKTYJKYJSFPN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|