C9H15N3O2S — CID 133386855
N-(4-methylsulfonylbutan-2-yl)pyrimidin-2-amine (PubChem CID 133386855) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is N-(4-methylsulfonylbutan-2-yl)pyrimidin-2-amine.
| Compound Name | N-(4-methylsulfonylbutan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133386855 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(4-methylsulfonylbutan-2-yl)pyrimidin-2-amine |
| SMILES | CC(CCS(C)(=O)=O)Nc1ncccn1 |
| InChI | InChI=1S/C9H15N3O2S/c1-8(4-7-15(2,13)14)12-9-10-5-3-6-11-9/h3,5-6,8H,4,7H2,1-2H3,(H,10,11,12) |
| InChIKey | RRFWLEKWQXADLU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |