C10H12ClN3 — CID 130535478
5-chloro-2-N-pent-4-yn-2-ylpyridine-2,3-diamine (PubChem CID 130535478) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 5-chloro-2-N-pent-4-yn-2-ylpyridine-2,3-diamine.
| Compound Name | 5-chloro-2-N-pent-4-yn-2-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 130535478 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 5-chloro-2-N-pent-4-yn-2-ylpyridine-2,3-diamine |
| SMILES | C#CCC(C)Nc1ncc(Cl)cc1N |
| InChI | InChI=1S/C10H12ClN3/c1-3-4-7(2)14-10-9(12)5-8(11)6-13-10/h1,5-7H,4,12H2,2H3,(H,13,14) |
| InChIKey | SADUASXSFTUOGP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|