C14H25N3 — CID 66281281
5-methyl-2-N-(6-methylheptan-2-yl)pyridine-2,3-diamine (PubChem CID 66281281) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 5-methyl-2-N-(6-methylheptan-2-yl)pyridine-2,3-diamine.
| Compound Name | 5-methyl-2-N-(6-methylheptan-2-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 66281281 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 5-methyl-2-N-(6-methylheptan-2-yl)pyridine-2,3-diamine |
| SMILES | Cc1cnc(NC(C)CCCC(C)C)c(N)c1 |
| InChI | InChI=1S/C14H25N3/c1-10(2)6-5-7-12(4)17-14-13(15)8-11(3)9-16-14/h8-10,12H,5-7,15H2,1-4H3,(H,16,17) |
| InChIKey | MRLUEPOLBQIOBO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |