C12H21ClN4 — CID 63022217
6-chloro-4-N-(6-methylheptan-2-yl)pyrimidine-4,5-diamine (PubChem CID 63022217) has the molecular formula C12H21ClN4 and a molecular weight of 256.78 g/mol. Its IUPAC name is 6-chloro-4-N-(6-methylheptan-2-yl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-(6-methylheptan-2-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 63022217 |
| Molecular Formula | C12H21ClN4 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 6-chloro-4-N-(6-methylheptan-2-yl)pyrimidine-4,5-diamine |
| SMILES | CC(C)CCCC(C)Nc1ncnc(Cl)c1N |
| InChI | InChI=1S/C12H21ClN4/c1-8(2)5-4-6-9(3)17-12-10(14)11(13)15-7-16-12/h7-9H,4-6,14H2,1-3H3,(H,15,16,17) |
| InChIKey | XTQXEVFLEJOELX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |