C14H25ClN4O — CID 131878005
2-[(5-amino-6-chloropyrimidin-4-yl)amino]decan-1-ol (PubChem CID 131878005) has the molecular formula C14H25ClN4O and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-[(5-amino-6-chloropyrimidin-4-yl)amino]decan-1-ol.
| Compound Name | 2-[(5-amino-6-chloropyrimidin-4-yl)amino]decan-1-ol |
|---|---|
| PubChem CID | 131878005 |
| Molecular Formula | C14H25ClN4O |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[(5-amino-6-chloropyrimidin-4-yl)amino]decan-1-ol |
| SMILES | CCCCCCCCC(CO)Nc1ncnc(Cl)c1N |
| InChI | InChI=1S/C14H25ClN4O/c1-2-3-4-5-6-7-8-11(9-20)19-14-12(16)13(15)17-10-18-14/h10-11,20H,2-9,16H2,1H3,(H,17,18,19) |
| InChIKey | GGEMSDNXKNVXLX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|