C11H18ClN5O3 — CID 138013300
2-[(5-amino-6-chloropyrimidin-4-yl)amino]-N-(1-hydroxy-4-methoxybutan-2-yl)acetamide (PubChem CID 138013300) has the molecular formula C11H18ClN5O3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-[(5-amino-6-chloropyrimidin-4-yl)amino]-N-(1-hydroxy-4-methoxybutan-2-yl)acetamide.
| Compound Name | 2-[(5-amino-6-chloropyrimidin-4-yl)amino]-N-(1-hydroxy-4-methoxybutan-2-yl)acetamide |
|---|---|
| PubChem CID | 138013300 |
| Molecular Formula | C11H18ClN5O3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[(5-amino-6-chloropyrimidin-4-yl)amino]-N-(1-hydroxy-4-methoxybutan-2-yl)acetamide |
| SMILES | COCCC(CO)NC(=O)CNc1ncnc(Cl)c1N |
| InChI | InChI=1S/C11H18ClN5O3/c1-20-3-2-7(5-18)17-8(19)4-14-11-9(13)10(12)15-6-16-11/h6-7,18H,2-5,13H2,1H3,(H,17,19)(H,14,15,16) |
| InChIKey | DEGGMFNGPFEFPB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |