C8H13ClN4O — CID 112695149
1-[(5-amino-6-chloropyrimidin-4-yl)amino]butan-2-ol (PubChem CID 112695149) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 1-[(5-amino-6-chloropyrimidin-4-yl)amino]butan-2-ol.
| Compound Name | 1-[(5-amino-6-chloropyrimidin-4-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 112695149 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-[(5-amino-6-chloropyrimidin-4-yl)amino]butan-2-ol |
| SMILES | CCC(O)CNc1ncnc(Cl)c1N |
| InChI | InChI=1S/C8H13ClN4O/c1-2-5(14)3-11-8-6(10)7(9)12-4-13-8/h4-5,14H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | HFSPQEZIGCOYLS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |