C9H15ClN4O2 — CID 106243066
4-[(5-amino-6-chloropyrimidin-4-yl)amino]-1-methoxybutan-2-ol (PubChem CID 106243066) has the molecular formula C9H15ClN4O2 and a molecular weight of 246.70 g/mol. Its IUPAC name is 4-[(5-amino-6-chloropyrimidin-4-yl)amino]-1-methoxybutan-2-ol.
| Compound Name | 4-[(5-amino-6-chloropyrimidin-4-yl)amino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106243066 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-[(5-amino-6-chloropyrimidin-4-yl)amino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNc1ncnc(Cl)c1N |
| InChI | InChI=1S/C9H15ClN4O2/c1-16-4-6(15)2-3-12-9-7(11)8(10)13-5-14-9/h5-6,15H,2-4,11H2,1H3,(H,12,13,14) |
| InChIKey | OEVWTHDAVFSMAL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |