C8H12ClN3O — CID 130680092
(2S)-1-[(5-chloropyrimidin-2-yl)amino]butan-2-ol (PubChem CID 130680092) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is (2S)-1-[(5-chloropyrimidin-2-yl)amino]butan-2-ol.
| Compound Name | (2S)-1-[(5-chloropyrimidin-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 130680092 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (2S)-1-[(5-chloropyrimidin-2-yl)amino]butan-2-ol |
| SMILES | CC[C@H](O)CNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C8H12ClN3O/c1-2-7(13)5-12-8-10-3-6(9)4-11-8/h3-4,7,13H,2,5H2,1H3,(H,10,11,12)/t7-/m0/s1 |
| InChIKey | XTMJINPNUSQOQD-ZETCQYMHSA-N |
| XLogP | 1.31 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |