C8H12ClN3S — CID 115756039
5-chloro-N-(2-methylsulfanylpropyl)pyrimidin-2-amine (PubChem CID 115756039) has the molecular formula C8H12ClN3S and a molecular weight of 217.72 g/mol. Its IUPAC name is 5-chloro-N-(2-methylsulfanylpropyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-(2-methylsulfanylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115756039 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-chloro-N-(2-methylsulfanylpropyl)pyrimidin-2-amine |
| SMILES | CSC(C)CNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C8H12ClN3S/c1-6(13-2)3-10-8-11-4-7(9)5-12-8/h4-6H,3H2,1-2H3,(H,10,11,12) |
| InChIKey | ZFZLBIZXZYATKJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |