C7H15NO3 — CID 157037781
N-[(2S)-1-hydroxy-4-methoxybutan-2-yl]acetamide (PubChem CID 157037781) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-4-methoxybutan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-hydroxy-4-methoxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 157037781 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | N-[(2S)-1-hydroxy-4-methoxybutan-2-yl]acetamide |
| SMILES | COCC[C@@H](CO)NC(C)=O |
| InChI | InChI=1S/C7H15NO3/c1-6(10)8-7(5-9)3-4-11-2/h7,9H,3-5H2,1-2H3,(H,8,10)/t7-/m0/s1 |
| InChIKey | MPIDOXMZVIORFL-ZETCQYMHSA-N |
| XLogP | -0.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |