C15H30N2O4 — CID 138044918
(3S)-3-(acetamidomethyl)-N-(1-hydroxy-4-methoxybutan-2-yl)-5-methylhexanamide (PubChem CID 138044918) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is (3S)-3-(acetamidomethyl)-N-(1-hydroxy-4-methoxybutan-2-yl)-5-methylhexanamide.
| Compound Name | (3S)-3-(acetamidomethyl)-N-(1-hydroxy-4-methoxybutan-2-yl)-5-methylhexanamide |
|---|---|
| PubChem CID | 138044918 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3S)-3-(acetamidomethyl)-N-(1-hydroxy-4-methoxybutan-2-yl)-5-methylhexanamide |
| SMILES | COCCC(CO)NC(=O)C[C@@H](CNC(C)=O)CC(C)C |
| InChI | InChI=1S/C15H30N2O4/c1-11(2)7-13(9-16-12(3)19)8-15(20)17-14(10-18)5-6-21-4/h11,13-14,18H,5-10H2,1-4H3,(H,16,19)(H,17,20)/t13-,14?/m0/s1 |
| InChIKey | BVIGMOGNFOJMAN-LSLKUGRBSA-N |
| XLogP | 0.69 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |