C11H23NO4 — CID 10609681
N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3,3-dimethoxypropanamide (PubChem CID 10609681) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3,3-dimethoxypropanamide.
| Compound Name | N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3,3-dimethoxypropanamide |
|---|---|
| PubChem CID | 10609681 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3,3-dimethoxypropanamide |
| SMILES | COC(CC(=O)N[C@H](CO)CC(C)C)OC |
| InChI | InChI=1S/C11H23NO4/c1-8(2)5-9(7-13)12-10(14)6-11(15-3)16-4/h8-9,11,13H,5-7H2,1-4H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | ZJJJEQMEERTTJJ-VIFPVBQESA-N |
| XLogP | 0.52 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|