C9H12ClN3O3 — CID 106192408
4-chloro-6-[(1-hydroxy-3-methoxypropan-2-yl)amino]pyrimidine-5-carbaldehyde (PubChem CID 106192408) has the molecular formula C9H12ClN3O3 and a molecular weight of 245.67 g/mol. Its IUPAC name is 4-chloro-6-[(1-hydroxy-3-methoxypropan-2-yl)amino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-[(1-hydroxy-3-methoxypropan-2-yl)amino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 106192408 |
| Molecular Formula | C9H12ClN3O3 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-chloro-6-[(1-hydroxy-3-methoxypropan-2-yl)amino]pyrimidine-5-carbaldehyde |
| SMILES | COCC(CO)Nc1ncnc(Cl)c1C=O |
| InChI | InChI=1S/C9H12ClN3O3/c1-16-4-6(2-14)13-9-7(3-15)8(10)11-5-12-9/h3,5-6,14H,2,4H2,1H3,(H,11,12,13) |
| InChIKey | HXOSIAHGWRCOHT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|