C8H14BrN5O2 — CID 106198983
2-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]-3-methoxypropan-1-ol (PubChem CID 106198983) has the molecular formula C8H14BrN5O2 and a molecular weight of 292.14 g/mol. Its IUPAC name is 2-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]-3-methoxypropan-1-ol.
| Compound Name | 2-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106198983 |
| Molecular Formula | C8H14BrN5O2 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]-3-methoxypropan-1-ol |
| SMILES | COCC(CO)Nc1ncnc(NN)c1Br |
| InChI | InChI=1S/C8H14BrN5O2/c1-16-3-5(2-15)13-7-6(9)8(14-10)12-4-11-7/h4-5,15H,2-3,10H2,1H3,(H2,11,12,13,14) |
| InChIKey | OZFUDRQGHISPBT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|