C10H12BrCl2NO2 — CID 63686996
4-bromo-2,6-dichloro-N-(2,2-dimethoxyethyl)aniline (PubChem CID 63686996) has the molecular formula C10H12BrCl2NO2 and a molecular weight of 329.02 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2,2-dimethoxyethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(2,2-dimethoxyethyl)aniline |
|---|---|
| PubChem CID | 63686996 |
| Molecular Formula | C10H12BrCl2NO2 |
| Molecular Weight | 329.02 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2,2-dimethoxyethyl)aniline |
| SMILES | COC(CNc1c(Cl)cc(Br)cc1Cl)OC |
| InChI | InChI=1S/C10H12BrCl2NO2/c1-15-9(16-2)5-14-10-7(12)3-6(11)4-8(10)13/h3-4,9,14H,5H2,1-2H3 |
| InChIKey | DEYPJBLKJQGCMN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|