C12H16BrCl2NO — CID 106451560
4-bromo-2,6-dichloro-N-[2-(2-methylpropoxy)ethyl]aniline (PubChem CID 106451560) has the molecular formula C12H16BrCl2NO and a molecular weight of 341.08 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[2-(2-methylpropoxy)ethyl]aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-[2-(2-methylpropoxy)ethyl]aniline |
|---|---|
| PubChem CID | 106451560 |
| Molecular Formula | C12H16BrCl2NO |
| Molecular Weight | 341.08 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[2-(2-methylpropoxy)ethyl]aniline |
| SMILES | CC(C)COCCNc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H16BrCl2NO/c1-8(2)7-17-4-3-16-12-10(14)5-9(13)6-11(12)15/h5-6,8,16H,3-4,7H2,1-2H3 |
| InChIKey | RZYKKGWYEONNDB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|