C13H19BrClNO — CID 115904861
N-[(3-bromo-4-chlorophenyl)methyl]-2-(2-methylpropoxy)ethanamine (PubChem CID 115904861) has the molecular formula C13H19BrClNO and a molecular weight of 320.66 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)methyl]-2-(2-methylpropoxy)ethanamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)methyl]-2-(2-methylpropoxy)ethanamine |
|---|---|
| PubChem CID | 115904861 |
| Molecular Formula | C13H19BrClNO |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)methyl]-2-(2-methylpropoxy)ethanamine |
| SMILES | CC(C)COCCNCc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H19BrClNO/c1-10(2)9-17-6-5-16-8-11-3-4-13(15)12(14)7-11/h3-4,7,10,16H,5-6,8-9H2,1-2H3 |
| InChIKey | OXAKWYXUOMVWBV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|