C11H16BrNO3 — CID 63697779
5-bromo-N-(2,2-dimethoxyethyl)-2-methoxyaniline (PubChem CID 63697779) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethoxyethyl)-2-methoxyaniline.
| Compound Name | 5-bromo-N-(2,2-dimethoxyethyl)-2-methoxyaniline |
|---|---|
| PubChem CID | 63697779 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-bromo-N-(2,2-dimethoxyethyl)-2-methoxyaniline |
| SMILES | COc1ccc(Br)cc1NCC(OC)OC |
| InChI | InChI=1S/C11H16BrNO3/c1-14-10-5-4-8(12)6-9(10)13-7-11(15-2)16-3/h4-6,11,13H,7H2,1-3H3 |
| InChIKey | SMLVROFVYNXUNC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|