C16H16BrCl2N — CID 63425141
4-bromo-2,6-dichloro-N-[(4-propan-2-ylphenyl)methyl]aniline (PubChem CID 63425141) has the molecular formula C16H16BrCl2N and a molecular weight of 373.12 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[(4-propan-2-ylphenyl)methyl]aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-[(4-propan-2-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 63425141 |
| Molecular Formula | C16H16BrCl2N |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[(4-propan-2-ylphenyl)methyl]aniline |
| SMILES | CC(C)c1ccc(CNc2c(Cl)cc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16BrCl2N/c1-10(2)12-5-3-11(4-6-12)9-20-16-14(18)7-13(17)8-15(16)19/h3-8,10,20H,9H2,1-2H3 |
| InChIKey | UKHILMAKZKJHMT-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |