C11H8BrCl2NS — CID 28993157
4-bromo-2,6-dichloro-N-(thiophen-3-ylmethyl)aniline (PubChem CID 28993157) has the molecular formula C11H8BrCl2NS and a molecular weight of 337.07 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(thiophen-3-ylmethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(thiophen-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 28993157 |
| Molecular Formula | C11H8BrCl2NS |
| Molecular Weight | 337.07 g/mol |
| Exact Mass | 334.89 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(thiophen-3-ylmethyl)aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NCc1ccsc1 |
| InChI | InChI=1S/C11H8BrCl2NS/c12-8-3-9(13)11(10(14)4-8)15-5-7-1-2-16-6-7/h1-4,6,15H,5H2 |
| InChIKey | ZTWWBOWLKUJHIV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.07 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |