C11H15BrClNO3 — CID 55233671
3-bromo-5-chloro-N-(2,2-dimethoxyethyl)-2-methoxyaniline (PubChem CID 55233671) has the molecular formula C11H15BrClNO3 and a molecular weight of 324.60 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(2,2-dimethoxyethyl)-2-methoxyaniline.
| Compound Name | 3-bromo-5-chloro-N-(2,2-dimethoxyethyl)-2-methoxyaniline |
|---|---|
| PubChem CID | 55233671 |
| Molecular Formula | C11H15BrClNO3 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 3-bromo-5-chloro-N-(2,2-dimethoxyethyl)-2-methoxyaniline |
| SMILES | COc1c(Br)cc(Cl)cc1NCC(OC)OC |
| InChI | InChI=1S/C11H15BrClNO3/c1-15-10(16-2)6-14-9-5-7(13)4-8(12)11(9)17-3/h4-5,10,14H,6H2,1-3H3 |
| InChIKey | LZSNXMHMUCTOSC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|