C11H14Cl2N2O3 — CID 104917732
2,6-dichloro-N-(2-ethoxypropyl)-4-nitroaniline (PubChem CID 104917732) has the molecular formula C11H14Cl2N2O3 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-ethoxypropyl)-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-(2-ethoxypropyl)-4-nitroaniline |
|---|---|
| PubChem CID | 104917732 |
| Molecular Formula | C11H14Cl2N2O3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2,6-dichloro-N-(2-ethoxypropyl)-4-nitroaniline |
| SMILES | CCOC(C)CNc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O3/c1-3-18-7(2)6-14-11-9(12)4-8(15(16)17)5-10(11)13/h4-5,7,14H,3,6H2,1-2H3 |
| InChIKey | JAVPBLCCZHNBRN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|