C13H19Cl2N3O2 — CID 106891864
2-N-(2,6-dichloro-4-nitrophenyl)-2,4-dimethylpentane-1,2-diamine (PubChem CID 106891864) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-N-(2,6-dichloro-4-nitrophenyl)-2,4-dimethylpentane-1,2-diamine.
| Compound Name | 2-N-(2,6-dichloro-4-nitrophenyl)-2,4-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 106891864 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-N-(2,6-dichloro-4-nitrophenyl)-2,4-dimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(C)(CN)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H19Cl2N3O2/c1-8(2)6-13(3,7-16)17-12-10(14)4-9(18(19)20)5-11(12)15/h4-5,8,17H,6-7,16H2,1-3H3 |
| InChIKey | LXTPTULPQMCLGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|