C12H20N4O2 — CID 104540937
2,4-dimethyl-2-N-(2-nitro-3-pyridinyl)pentane-1,2-diamine (PubChem CID 104540937) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2,4-dimethyl-2-N-(2-nitro-3-pyridinyl)pentane-1,2-diamine.
| Compound Name | 2,4-dimethyl-2-N-(2-nitro-3-pyridinyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 104540937 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,4-dimethyl-2-N-(2-nitro-3-pyridinyl)pentane-1,2-diamine |
| SMILES | CC(C)CC(C)(CN)Nc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N4O2/c1-9(2)7-12(3,8-13)15-10-5-4-6-14-11(10)16(17)18/h4-6,9,15H,7-8,13H2,1-3H3 |
| InChIKey | SSIAGKORKLXVTC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|