C16H22ClN3 — CID 116783607
2-N-(5-chloroquinolin-8-yl)-2,4-dimethylpentane-1,2-diamine (PubChem CID 116783607) has the molecular formula C16H22ClN3 and a molecular weight of 291.83 g/mol. Its IUPAC name is 2-N-(5-chloroquinolin-8-yl)-2,4-dimethylpentane-1,2-diamine.
| Compound Name | 2-N-(5-chloroquinolin-8-yl)-2,4-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 116783607 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-N-(5-chloroquinolin-8-yl)-2,4-dimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(C)(CN)Nc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C16H22ClN3/c1-11(2)9-16(3,10-18)20-14-7-6-13(17)12-5-4-8-19-15(12)14/h4-8,11,20H,9-10,18H2,1-3H3 |
| InChIKey | NRRVLDWVXFWQNE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |