C14H23N3O5S — CID 119985029
N-(1-amino-2,4-dimethylpentan-2-yl)-2-methoxy-5-nitrobenzenesulfonamide (PubChem CID 119985029) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-methoxy-5-nitrobenzenesulfonamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-methoxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119985029 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-methoxy-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC(C)(CN)CC(C)C |
| InChI | InChI=1S/C14H23N3O5S/c1-10(2)8-14(3,9-15)16-23(20,21)13-7-11(17(18)19)5-6-12(13)22-4/h5-7,10,16H,8-9,15H2,1-4H3 |
| InChIKey | KXPOMYYJIJUXRO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|