C15H25N3O4S — CID 119985363
N-(1-amino-2,4-dimethylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide (PubChem CID 119985363) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119985363 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)NC(C)(CN)CC(C)C)c1C |
| InChI | InChI=1S/C15H25N3O4S/c1-10(2)8-15(5,9-16)17-23(21,22)14-12(4)11(3)6-7-13(14)18(19)20/h6-7,10,17H,8-9,16H2,1-5H3 |
| InChIKey | GUHWJORMMMJBIE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|