C12H16N2O7S — CID 122071366
3-[(2,3-dimethyl-6-nitrophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122071366) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is 3-[(2,3-dimethyl-6-nitrophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(2,3-dimethyl-6-nitrophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122071366 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-[(2,3-dimethyl-6-nitrophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)NCC(C)(O)C(=O)O)c1C |
| InChI | InChI=1S/C12H16N2O7S/c1-7-4-5-9(14(18)19)10(8(7)2)22(20,21)13-6-12(3,17)11(15)16/h4-5,13,17H,6H2,1-3H3,(H,15,16) |
| InChIKey | UETLCZQRDGZCEG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|