C13H20N2O7S2 — CID 122071580
2-hydroxy-2-methyl-3-[[4-(propylsulfamoyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 122071580) has the molecular formula C13H20N2O7S2 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-[[4-(propylsulfamoyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-[[4-(propylsulfamoyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 122071580 |
| Molecular Formula | C13H20N2O7S2 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-hydroxy-2-methyl-3-[[4-(propylsulfamoyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | CCCNS(=O)(=O)c1ccc(S(=O)(=O)NCC(C)(O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H20N2O7S2/c1-3-8-14-23(19,20)10-4-6-11(7-5-10)24(21,22)15-9-13(2,18)12(16)17/h4-7,14-15,18H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | FWRTXQAGPHFZAN-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |