C11H11FN2O5S — CID 66172413
3-[(3-cyano-4-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66172413) has the molecular formula C11H11FN2O5S and a molecular weight of 302.28 g/mol. Its IUPAC name is 3-[(3-cyano-4-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(3-cyano-4-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66172413 |
| Molecular Formula | C11H11FN2O5S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[(3-cyano-4-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNS(=O)(=O)c1ccc(F)c(C#N)c1)C(=O)O |
| InChI | InChI=1S/C11H11FN2O5S/c1-11(17,10(15)16)6-14-20(18,19)8-2-3-9(12)7(4-8)5-13/h2-4,14,17H,6H2,1H3,(H,15,16) |
| InChIKey | GAXAJWJGULIYKK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |