C14H24ClN3O4S — CID 119981515
N-[3-(aminomethyl)pentan-3-yl]-2,3-dimethyl-6-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119981515) has the molecular formula C14H24ClN3O4S and a molecular weight of 365.88 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2,3-dimethyl-6-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2,3-dimethyl-6-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119981515 |
| Molecular Formula | C14H24ClN3O4S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2,3-dimethyl-6-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1c([N+](=O)[O-])ccc(C)c1C.Cl |
| InChI | InChI=1S/C14H23N3O4S.ClH/c1-5-14(6-2,9-15)16-22(20,21)13-11(4)10(3)7-8-12(13)17(18)19;/h7-8,16H,5-6,9,15H2,1-4H3;1H |
| InChIKey | YKEDIUNCWKLMIK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|