C14H23N3O4S — CID 119983426
N-(1-amino-4-methylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide (PubChem CID 119983426) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119983426 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)NC(CN)CC(C)C)c1C |
| InChI | InChI=1S/C14H23N3O4S/c1-9(2)7-12(8-15)16-22(20,21)14-11(4)10(3)5-6-13(14)17(18)19/h5-6,9,12,16H,7-8,15H2,1-4H3 |
| InChIKey | ROGCEDXEKMDWSQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|