C13H21ClFN3O5S — CID 120710739
N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120710739) has the molecular formula C13H21ClFN3O5S and a molecular weight of 385.85 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120710739 |
| Molecular Formula | C13H21ClFN3O5S |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1c(F)cc(S(=O)(=O)NC(CN)CC(C)C)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H20FN3O5S.ClH/c1-8(2)4-9(7-15)16-23(20,21)10-5-11(14)13(22-3)12(6-10)17(18)19;/h5-6,8-9,16H,4,7,15H2,1-3H3;1H |
| InChIKey | HLGXCWLBNNIDMB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|